C19H24ClN3O3S — CID 71631274
tert-butyl 3-[(3-chloroquinoxalin-2-yl)sulfinylmethyl]piperidine-1-carboxylate (PubChem CID 71631274) has the molecular formula C19H24ClN3O3S and a molecular weight of 409.94 g/mol. Its IUPAC name is tert-butyl 3-[(3-chloroquinoxalin-2-yl)sulfinylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-chloroquinoxalin-2-yl)sulfinylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71631274 |
| Molecular Formula | C19H24ClN3O3S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | tert-butyl 3-[(3-chloroquinoxalin-2-yl)sulfinylmethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CS(=O)c2nc3ccccc3nc2Cl)C1 |
| InChI | InChI=1S/C19H24ClN3O3S/c1-19(2,3)26-18(24)23-10-6-7-13(11-23)12-27(25)17-16(20)21-14-8-4-5-9-15(14)22-17/h4-5,8-9,13H,6-7,10-12H2,1-3H3 |
| InChIKey | OJWXGRQFDWTTPR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |