About 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide
2-(1,3-benzothiazol-2-ylsulfanyl)acetamide (PubChem CID 716336) has the molecular formula C9H8N2OS2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide.
Molecular Properties
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide |
| PubChem CID | 716336 |
| Molecular Formula | C9H8N2OS2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide |
| SMILES | NC(=O)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H8N2OS2/c10-8(12)5-13-9-11-6-3-1-2-4-7(6)14-9/h1-4H,5H2,(H2,10,12) |
| InChIKey | XZQXBISQHWDZBS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide?
The IUPAC name of 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide (CID 716336) is 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide.
What is the SMILES notation for 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide?
The canonical SMILES for 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide is NC(=O)CSc1nc2ccccc2s1.
What is the InChIKey of 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide?
The InChIKey is XZQXBISQHWDZBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2OS2/c10-8(12)5-13-9-11-6-3-1-2-4-7(6)14-9/h1-4H,5H2,(H2,10,12).
What are the key properties of 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide?
2-(1,3-benzothiazol-2-ylsulfanyl)acetamide has a molecular weight of 224.31 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzothiazol-2-ylsulfanyl)acetamide is sourced from PubChem (CID 716336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).