C19H31BN4O5 — CID 71633784
2,3-dihydroxy-N-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]cyclohexyl]propanamide (PubChem CID 71633784) has the molecular formula C19H31BN4O5 and a molecular weight of 406.29 g/mol. Its IUPAC name is 2,3-dihydroxy-N-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]cyclohexyl]propanamide.
| Compound Name | 2,3-dihydroxy-N-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 71633784 |
| Molecular Formula | C19H31BN4O5 |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2,3-dihydroxy-N-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]cyclohexyl]propanamide |
| SMILES | CC1(C)OB(c2cnc(NC3CCC(NC(=O)C(O)CO)CC3)nc2)OC1(C)C |
| InChI | InChI=1S/C19H31BN4O5/c1-18(2)19(3,4)29-20(28-18)12-9-21-17(22-10-12)24-14-7-5-13(6-8-14)23-16(27)15(26)11-25/h9-10,13-15,25-26H,5-8,11H2,1-4H3,(H,23,27)(H,21,22,24) |
| InChIKey | CKOPPGKQJYSOLQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 125.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|