C16H27BN4O3 — CID 71633865
2-[[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]pyrrolidin-3-yl]amino]ethanol (PubChem CID 71633865) has the molecular formula C16H27BN4O3 and a molecular weight of 334.23 g/mol. Its IUPAC name is 2-[[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]pyrrolidin-3-yl]amino]ethanol.
| Compound Name | 2-[[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]pyrrolidin-3-yl]amino]ethanol |
|---|---|
| PubChem CID | 71633865 |
| Molecular Formula | C16H27BN4O3 |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 2-[[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]pyrrolidin-3-yl]amino]ethanol |
| SMILES | CC1(C)OB(c2cnc(N3CCC(NCCO)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C16H27BN4O3/c1-15(2)16(3,4)24-17(23-15)12-9-19-14(20-10-12)21-7-5-13(11-21)18-6-8-22/h9-10,13,18,22H,5-8,11H2,1-4H3 |
| InChIKey | LGYKJOOCOPCERQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|