C15H22BF2N3O2 — CID 71633880
2-(4,4-difluoropiperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (PubChem CID 71633880) has the molecular formula C15H22BF2N3O2 and a molecular weight of 325.17 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 71633880 |
| Molecular Formula | C15H22BF2N3O2 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| SMILES | CC1(C)OB(c2cnc(N3CCC(F)(F)CC3)nc2)OC1(C)C |
| InChI | InChI=1S/C15H22BF2N3O2/c1-13(2)14(3,4)23-16(22-13)11-9-19-12(20-10-11)21-7-5-15(17,18)6-8-21/h9-10H,5-8H2,1-4H3 |
| InChIKey | MOJYSMZHROABNI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|