C16H16N6O2S — CID 7163391
(2S)-N,N-dimethyl-3-oxo-2-(3-phenyltriazolo[4,5-d]pyrimidin-7-yl)sulfanylbutanamide (PubChem CID 7163391) has the molecular formula C16H16N6O2S and a molecular weight of 356.41 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-3-oxo-2-(3-phenyltriazolo[4,5-d]pyrimidin-7-yl)sulfanylbutanamide.
| Compound Name | (2S)-N,N-dimethyl-3-oxo-2-(3-phenyltriazolo[4,5-d]pyrimidin-7-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 7163391 |
| Molecular Formula | C16H16N6O2S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (2S)-N,N-dimethyl-3-oxo-2-(3-phenyltriazolo[4,5-d]pyrimidin-7-yl)sulfanylbutanamide |
| SMILES | CC(=O)[C@H](Sc1ncnc2c1nnn2-c1ccccc1)C(=O)N(C)C |
| InChI | InChI=1S/C16H16N6O2S/c1-10(23)13(16(24)21(2)3)25-15-12-14(17-9-18-15)22(20-19-12)11-7-5-4-6-8-11/h4-9,13H,1-3H3/t13-/m0/s1 |
| InChIKey | HHHNCSRXLPXVBP-ZDUSSCGKSA-N |
| XLogP | 1.35 |
| TPSA | 93.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|