C17H28BN3O5S — CID 71633926
2-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]ethanol (PubChem CID 71633926) has the molecular formula C17H28BN3O5S and a molecular weight of 397.31 g/mol. Its IUPAC name is 2-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]ethanol.
| Compound Name | 2-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 71633926 |
| Molecular Formula | C17H28BN3O5S |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]ethanol |
| SMILES | CC1(C)OB(c2cnc(S(=O)(=O)[C@@H]3CCCN(CCO)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C17H28BN3O5S/c1-16(2)17(3,4)26-18(25-16)13-10-19-15(20-11-13)27(23,24)14-6-5-7-21(12-14)8-9-22/h10-11,14,22H,5-9,12H2,1-4H3/t14-/m1/s1 |
| InChIKey | KDVQIPPMZUCMJV-CQSZACIVSA-N |
| XLogP | 0.01 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|