C18H29BN4O5 — CID 71634962
2,3-dihydroxy-1-[3-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperazin-1-yl]propan-1-one (PubChem CID 71634962) has the molecular formula C18H29BN4O5 and a molecular weight of 392.27 g/mol. Its IUPAC name is 2,3-dihydroxy-1-[3-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 2,3-dihydroxy-1-[3-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 71634962 |
| Molecular Formula | C18H29BN4O5 |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2,3-dihydroxy-1-[3-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperazin-1-yl]propan-1-one |
| SMILES | CC1CN(C(=O)C(O)CO)CCN1c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C18H29BN4O5/c1-12-10-22(15(26)14(25)11-24)6-7-23(12)16-20-8-13(9-21-16)19-27-17(2,3)18(4,5)28-19/h8-9,12,14,24-25H,6-7,10-11H2,1-5H3 |
| InChIKey | YDFDBGQQXPQPAF-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|