About 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile
4-(2-methyl-1,3-thiazol-4-yl)benzonitrile (PubChem CID 716353) has the molecular formula C11H8N2S
and a molecular weight of 200.27 g/mol. Its IUPAC name is 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile |
| PubChem CID | 716353 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile |
| SMILES | Cc1nc(-c2ccc(C#N)cc2)cs1 |
| InChI | InChI=1S/C11H8N2S/c1-8-13-11(7-14-8)10-4-2-9(6-12)3-5-10/h2-5,7H,1H3 |
| InChIKey | FOKBMJMDQCPNJI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile?
The IUPAC name of 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile (CID 716353) is 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile.
What is the SMILES notation for 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile?
The canonical SMILES for 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile is Cc1nc(-c2ccc(C#N)cc2)cs1.
What is the InChIKey of 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile?
The InChIKey is FOKBMJMDQCPNJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2S/c1-8-13-11(7-14-8)10-4-2-9(6-12)3-5-10/h2-5,7H,1H3.
What are the key properties of 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile?
4-(2-methyl-1,3-thiazol-4-yl)benzonitrile has a molecular weight of 200.27 g/mol, XLogP of 2.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,3-thiazol-4-yl)benzonitrile is sourced from PubChem (CID 716353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).