About 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride
5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride (PubChem CID 71635908) has the molecular formula C12H15ClN4O3
and a molecular weight of 298.73 g/mol. Its IUPAC name is 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride |
| PubChem CID | 71635908 |
| Molecular Formula | C12H15ClN4O3 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2oc(NCC3CCNC3)nc2c1 |
| InChI | InChI=1S/C12H14N4O3.ClH/c17-16(18)9-1-2-11-10(5-9)15-12(19-11)14-7-8-3-4-13-6-8;/h1-2,5,8,13H,3-4,6-7H2,(H,14,15);1H |
| InChIKey | IUTBKLPORSVDNE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride?
The IUPAC name of 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride (CID 71635908) is 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride.
What is the SMILES notation for 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride?
The canonical SMILES for 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride is Cl.O=[N+]([O-])c1ccc2oc(NCC3CCNC3)nc2c1.
What is the InChIKey of 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride?
The InChIKey is IUTBKLPORSVDNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O3.ClH/c17-16(18)9-1-2-11-10(5-9)15-12(19-11)14-7-8-3-4-13-6-8;/h1-2,5,8,13H,3-4,6-7H2,(H,14,15);1H.
What are the key properties of 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride?
5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride has a molecular weight of 298.73 g/mol, XLogP of 2.18, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-N-(pyrrolidin-3-ylmethyl)-1,3-benzoxazol-2-amine;hydrochloride is sourced from PubChem (CID 71635908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).