About 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride
5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride (PubChem CID 71636197) has the molecular formula C13H16ClN3O2S2
and a molecular weight of 345.88 g/mol. Its IUPAC name is 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride.
Molecular Properties
| Compound Name | 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride |
| PubChem CID | 71636197 |
| Molecular Formula | C13H16ClN3O2S2 |
| Molecular Weight | 345.88 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2sc(SCC3CCNCC3)nc2c1 |
| InChI | InChI=1S/C13H15N3O2S2.ClH/c17-16(18)10-1-2-12-11(7-10)15-13(20-12)19-8-9-3-5-14-6-4-9;/h1-2,7,9,14H,3-6,8H2;1H |
| InChIKey | ZMRDGGWDTFBMLF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride?
The IUPAC name of 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride (CID 71636197) is 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride.
What is the SMILES notation for 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride?
The canonical SMILES for 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride is Cl.O=[N+]([O-])c1ccc2sc(SCC3CCNCC3)nc2c1.
What is the InChIKey of 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride?
The InChIKey is ZMRDGGWDTFBMLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2S2.ClH/c17-16(18)10-1-2-12-11(7-10)15-13(20-12)19-8-9-3-5-14-6-4-9;/h1-2,7,9,14H,3-6,8H2;1H.
What are the key properties of 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride?
5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride has a molecular weight of 345.88 g/mol, XLogP of 3.72, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-(piperidin-4-ylmethylsulfanyl)-1,3-benzothiazole;hydrochloride is sourced from PubChem (CID 71636197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).