About N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride
N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride (PubChem CID 71637244) has the molecular formula C11H16ClN5
and a molecular weight of 253.74 g/mol. Its IUPAC name is N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride |
| PubChem CID | 71637244 |
| Molecular Formula | C11H16ClN5 |
| Molecular Weight | 253.74 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride |
| SMILES | Cl.c1cnc2nc(NC3CCNCC3)[nH]c2c1 |
| InChI | InChI=1S/C11H15N5.ClH/c1-2-9-10(13-5-1)16-11(15-9)14-8-3-6-12-7-4-8;/h1-2,5,8,12H,3-4,6-7H2,(H2,13,14,15,16);1H |
| InChIKey | NGNLYVNTXUVNHI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.74 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride?
The IUPAC name of N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride (CID 71637244) is N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride.
What is the SMILES notation for N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride?
The canonical SMILES for N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride is Cl.c1cnc2nc(NC3CCNCC3)[nH]c2c1.
What is the InChIKey of N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride?
The InChIKey is NGNLYVNTXUVNHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5.ClH/c1-2-9-10(13-5-1)16-11(15-9)14-8-3-6-12-7-4-8;/h1-2,5,8,12H,3-4,6-7H2,(H2,13,14,15,16);1H.
What are the key properties of N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride?
N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride has a molecular weight of 253.74 g/mol, XLogP of 1.54, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-piperidin-4-yl-1H-imidazo[4,5-b]pyridin-2-amine;hydrochloride is sourced from PubChem (CID 71637244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).