About (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride
(3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 71637692) has the molecular formula C9H16ClN3S
and a molecular weight of 233.77 g/mol. Its IUPAC name is (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride |
| PubChem CID | 71637692 |
| Molecular Formula | C9H16ClN3S |
| Molecular Weight | 233.77 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | CC(c1nccs1)N1CC[C@H](N)C1.Cl |
| InChI | InChI=1S/C9H15N3S.ClH/c1-7(9-11-3-5-13-9)12-4-2-8(10)6-12;/h3,5,7-8H,2,4,6,10H2,1H3;1H/t7?,8-;/m0./s1 |
| InChIKey | YSZYFXBZGQQTNG-MTICXXPYSA-N |
| XLogP | 1.66 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.77 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride?
The IUPAC name of (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride (CID 71637692) is (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride.
What is the SMILES notation for (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride?
The canonical SMILES for (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride is CC(c1nccs1)N1CC[C@H](N)C1.Cl.
What is the InChIKey of (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride?
The InChIKey is YSZYFXBZGQQTNG-MTICXXPYSA-N. The full InChI is InChI=1S/C9H15N3S.ClH/c1-7(9-11-3-5-13-9)12-4-2-8(10)6-12;/h3,5,7-8H,2,4,6,10H2,1H3;1H/t7?,8-;/m0./s1.
What are the key properties of (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride?
(3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride has a molecular weight of 233.77 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-[1-(1,3-thiazol-2-yl)ethyl]pyrrolidin-3-amine;hydrochloride is sourced from PubChem (CID 71637692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).