C12H19ClN2O — CID 71637869
2-[1-[(3R)-piperidin-3-yl]oxyethyl]pyridine;hydrochloride (PubChem CID 71637869) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 2-[1-[(3R)-piperidin-3-yl]oxyethyl]pyridine;hydrochloride.
| Compound Name | 2-[1-[(3R)-piperidin-3-yl]oxyethyl]pyridine;hydrochloride |
|---|---|
| PubChem CID | 71637869 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[1-[(3R)-piperidin-3-yl]oxyethyl]pyridine;hydrochloride |
| SMILES | CC(O[C@@H]1CCCNC1)c1ccccn1.Cl |
| InChI | InChI=1S/C12H18N2O.ClH/c1-10(12-6-2-3-8-14-12)15-11-5-4-7-13-9-11;/h2-3,6,8,10-11,13H,4-5,7,9H2,1H3;1H/t10?,11-;/m1./s1 |
| InChIKey | FRFPQYBOSJINIO-PSDUUTOMSA-N |
| XLogP | 2.33 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |