C9H14ClN3O — CID 71639242
4-methyl-2-pyrrolidin-3-yloxypyrimidine;hydrochloride (PubChem CID 71639242) has the molecular formula C9H14ClN3O and a molecular weight of 215.68 g/mol. Its IUPAC name is 4-methyl-2-pyrrolidin-3-yloxypyrimidine;hydrochloride.
| Compound Name | 4-methyl-2-pyrrolidin-3-yloxypyrimidine;hydrochloride |
|---|---|
| PubChem CID | 71639242 |
| Molecular Formula | C9H14ClN3O |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 4-methyl-2-pyrrolidin-3-yloxypyrimidine;hydrochloride |
| SMILES | Cc1ccnc(OC2CCNC2)n1.Cl |
| InChI | InChI=1S/C9H13N3O.ClH/c1-7-2-5-11-9(12-7)13-8-3-4-10-6-8;/h2,5,8,10H,3-4,6H2,1H3;1H |
| InChIKey | QOPIIGVRAUWNOH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |