C10H14Cl2N4 — CID 71639556
2,4-dichloro-5-[(2-methylpiperazin-1-yl)methyl]pyrimidine (PubChem CID 71639556) has the molecular formula C10H14Cl2N4 and a molecular weight of 261.16 g/mol. Its IUPAC name is 2,4-dichloro-5-[(2-methylpiperazin-1-yl)methyl]pyrimidine.
| Compound Name | 2,4-dichloro-5-[(2-methylpiperazin-1-yl)methyl]pyrimidine |
|---|---|
| PubChem CID | 71639556 |
| Molecular Formula | C10H14Cl2N4 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2,4-dichloro-5-[(2-methylpiperazin-1-yl)methyl]pyrimidine |
| SMILES | CC1CNCCN1Cc1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C10H14Cl2N4/c1-7-4-13-2-3-16(7)6-8-5-14-10(12)15-9(8)11/h5,7,13H,2-4,6H2,1H3 |
| InChIKey | FEESGHJZNLHNNC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |