C11H18ClN3 — CID 71641470
N-methyl-N-piperidin-4-ylpyridin-2-amine;hydrochloride (PubChem CID 71641470) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is N-methyl-N-piperidin-4-ylpyridin-2-amine;hydrochloride.
| Compound Name | N-methyl-N-piperidin-4-ylpyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71641470 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-methyl-N-piperidin-4-ylpyridin-2-amine;hydrochloride |
| SMILES | CN(c1ccccn1)C1CCNCC1.Cl |
| InChI | InChI=1S/C11H17N3.ClH/c1-14(10-5-8-12-9-6-10)11-4-2-3-7-13-11;/h2-4,7,10,12H,5-6,8-9H2,1H3;1H |
| InChIKey | NVEGXNUIZYWMHZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |