C12H19BrClN3 — CID 71641627
(3R)-N-[(2-bromo-4-pyridinyl)methyl]-N-methylpiperidin-3-amine;hydrochloride (PubChem CID 71641627) has the molecular formula C12H19BrClN3 and a molecular weight of 320.66 g/mol. Its IUPAC name is (3R)-N-[(2-bromo-4-pyridinyl)methyl]-N-methylpiperidin-3-amine;hydrochloride.
| Compound Name | (3R)-N-[(2-bromo-4-pyridinyl)methyl]-N-methylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71641627 |
| Molecular Formula | C12H19BrClN3 |
| Molecular Weight | 320.66 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (3R)-N-[(2-bromo-4-pyridinyl)methyl]-N-methylpiperidin-3-amine;hydrochloride |
| SMILES | CN(Cc1ccnc(Br)c1)[C@@H]1CCCNC1.Cl |
| InChI | InChI=1S/C12H18BrN3.ClH/c1-16(11-3-2-5-14-8-11)9-10-4-6-15-12(13)7-10;/h4,6-7,11,14H,2-3,5,8-9H2,1H3;1H/t11-;/m1./s1 |
| InChIKey | YBFLNDUBSQMASN-RFVHGSKJSA-N |
| XLogP | 2.45 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.66 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|