C10H16Cl2N4 — CID 71641771
(3S)-N-[(3-chloropyrazin-2-yl)methyl]-N-methylpyrrolidin-3-amine;hydrochloride (PubChem CID 71641771) has the molecular formula C10H16Cl2N4 and a molecular weight of 263.17 g/mol. Its IUPAC name is (3S)-N-[(3-chloropyrazin-2-yl)methyl]-N-methylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S)-N-[(3-chloropyrazin-2-yl)methyl]-N-methylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71641771 |
| Molecular Formula | C10H16Cl2N4 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (3S)-N-[(3-chloropyrazin-2-yl)methyl]-N-methylpyrrolidin-3-amine;hydrochloride |
| SMILES | CN(Cc1nccnc1Cl)[C@H]1CCNC1.Cl |
| InChI | InChI=1S/C10H15ClN4.ClH/c1-15(8-2-3-12-6-8)7-9-10(11)14-5-4-13-9;/h4-5,8,12H,2-3,6-7H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | CXBJLEXOLGKSIH-QRPNPIFTSA-N |
| XLogP | 1.35 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |