C11H19ClN4 — CID 71642141
N-methyl-N-(piperidin-3-ylmethyl)pyrazin-2-amine;hydrochloride (PubChem CID 71642141) has the molecular formula C11H19ClN4 and a molecular weight of 242.75 g/mol. Its IUPAC name is N-methyl-N-(piperidin-3-ylmethyl)pyrazin-2-amine;hydrochloride.
| Compound Name | N-methyl-N-(piperidin-3-ylmethyl)pyrazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71642141 |
| Molecular Formula | C11H19ClN4 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N-methyl-N-(piperidin-3-ylmethyl)pyrazin-2-amine;hydrochloride |
| SMILES | CN(CC1CCCNC1)c1cnccn1.Cl |
| InChI | InChI=1S/C11H18N4.ClH/c1-15(11-8-13-5-6-14-11)9-10-3-2-4-12-7-10;/h5-6,8,10,12H,2-4,7,9H2,1H3;1H |
| InChIKey | WCECHKNEZUWSIQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |