C13H22N4O — CID 71642921
N-[(3-methoxypyrazin-2-yl)methyl]-N-methyl-1-piperidin-3-ylmethanamine (PubChem CID 71642921) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is N-[(3-methoxypyrazin-2-yl)methyl]-N-methyl-1-piperidin-3-ylmethanamine.
| Compound Name | N-[(3-methoxypyrazin-2-yl)methyl]-N-methyl-1-piperidin-3-ylmethanamine |
|---|---|
| PubChem CID | 71642921 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-[(3-methoxypyrazin-2-yl)methyl]-N-methyl-1-piperidin-3-ylmethanamine |
| SMILES | COc1nccnc1CN(C)CC1CCCNC1 |
| InChI | InChI=1S/C13H22N4O/c1-17(9-11-4-3-5-14-8-11)10-12-13(18-2)16-7-6-15-12/h6-7,11,14H,3-5,8-10H2,1-2H3 |
| InChIKey | OYDFBLPTAIXGCV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |