About 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride
2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride (PubChem CID 71643126) has the molecular formula C7H16ClNO3S
and a molecular weight of 229.73 g/mol. Its IUPAC name is 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride.
Molecular Properties
| Compound Name | 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride |
| PubChem CID | 71643126 |
| Molecular Formula | C7H16ClNO3S |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride |
| SMILES | CS(=O)(=O)OCC[C@@H]1CCNC1.Cl |
| InChI | InChI=1S/C7H15NO3S.ClH/c1-12(9,10)11-5-3-7-2-4-8-6-7;/h7-8H,2-6H2,1H3;1H/t7-;/m0./s1 |
| InChIKey | FJXVIWYUWPAOCC-FJXQXJEOSA-N |
| XLogP | 0.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride?
The IUPAC name of 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride (CID 71643126) is 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride.
What is the SMILES notation for 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride?
The canonical SMILES for 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride is CS(=O)(=O)OCC[C@@H]1CCNC1.Cl.
What is the InChIKey of 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride?
The InChIKey is FJXVIWYUWPAOCC-FJXQXJEOSA-N. The full InChI is InChI=1S/C7H15NO3S.ClH/c1-12(9,10)11-5-3-7-2-4-8-6-7;/h7-8H,2-6H2,1H3;1H/t7-;/m0./s1.
What are the key properties of 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride?
2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride has a molecular weight of 229.73 g/mol, XLogP of 0.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-pyrrolidin-3-yl]ethyl methanesulfonate;hydrochloride is sourced from PubChem (CID 71643126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).