C11H18ClN3S2 — CID 71643270
2-methylsulfanyl-4-(piperidin-4-ylmethylsulfanyl)pyrimidine;hydrochloride (PubChem CID 71643270) has the molecular formula C11H18ClN3S2 and a molecular weight of 291.87 g/mol. Its IUPAC name is 2-methylsulfanyl-4-(piperidin-4-ylmethylsulfanyl)pyrimidine;hydrochloride.
| Compound Name | 2-methylsulfanyl-4-(piperidin-4-ylmethylsulfanyl)pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 71643270 |
| Molecular Formula | C11H18ClN3S2 |
| Molecular Weight | 291.87 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-methylsulfanyl-4-(piperidin-4-ylmethylsulfanyl)pyrimidine;hydrochloride |
| SMILES | CSc1nccc(SCC2CCNCC2)n1.Cl |
| InChI | InChI=1S/C11H17N3S2.ClH/c1-15-11-13-7-4-10(14-11)16-8-9-2-5-12-6-3-9;/h4,7,9,12H,2-3,5-6,8H2,1H3;1H |
| InChIKey | QPUXJNUTMQJLGL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.87 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |