C12H15Cl2F3N2O — CID 71643509
3-chloro-2-(piperidin-4-ylmethoxy)-5-(trifluoromethyl)pyridine;hydrochloride (PubChem CID 71643509) has the molecular formula C12H15Cl2F3N2O and a molecular weight of 331.17 g/mol. Its IUPAC name is 3-chloro-2-(piperidin-4-ylmethoxy)-5-(trifluoromethyl)pyridine;hydrochloride.
| Compound Name | 3-chloro-2-(piperidin-4-ylmethoxy)-5-(trifluoromethyl)pyridine;hydrochloride |
|---|---|
| PubChem CID | 71643509 |
| Molecular Formula | C12H15Cl2F3N2O |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 3-chloro-2-(piperidin-4-ylmethoxy)-5-(trifluoromethyl)pyridine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cnc(OCC2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C12H14ClF3N2O.ClH/c13-10-5-9(12(14,15)16)6-18-11(10)19-7-8-1-3-17-4-2-8;/h5-6,8,17H,1-4,7H2;1H |
| InChIKey | XULNDMKYXBDQSR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |