C12H16ClN3O2S — CID 71644216
1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-3-amine;hydrochloride (PubChem CID 71644216) has the molecular formula C12H16ClN3O2S and a molecular weight of 301.80 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-3-amine;hydrochloride.
| Compound Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71644216 |
| Molecular Formula | C12H16ClN3O2S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCCN(C2=NS(=O)(=O)c3ccccc32)C1 |
| InChI | InChI=1S/C12H15N3O2S.ClH/c13-9-4-3-7-15(8-9)12-10-5-1-2-6-11(10)18(16,17)14-12;/h1-2,5-6,9H,3-4,7-8,13H2;1H |
| InChIKey | UXRYFGWGMUDONM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |