C10H15BrClN3 — CID 71644404
1-[(2-bromo-4-pyridinyl)methyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 71644404) has the molecular formula C10H15BrClN3 and a molecular weight of 292.61 g/mol. Its IUPAC name is 1-[(2-bromo-4-pyridinyl)methyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-[(2-bromo-4-pyridinyl)methyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71644404 |
| Molecular Formula | C10H15BrClN3 |
| Molecular Weight | 292.61 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 1-[(2-bromo-4-pyridinyl)methyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCN(Cc2ccnc(Br)c2)C1 |
| InChI | InChI=1S/C10H14BrN3.ClH/c11-10-5-8(1-3-13-10)6-14-4-2-9(12)7-14;/h1,3,5,9H,2,4,6-7,12H2;1H |
| InChIKey | CIQNDJRJIYJFGT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.61 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|