C9H15ClN4 — CID 71644418
1-(pyrazin-2-ylmethyl)pyrrolidin-3-amine;hydrochloride (PubChem CID 71644418) has the molecular formula C9H15ClN4 and a molecular weight of 214.70 g/mol. Its IUPAC name is 1-(pyrazin-2-ylmethyl)pyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-(pyrazin-2-ylmethyl)pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71644418 |
| Molecular Formula | C9H15ClN4 |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1-(pyrazin-2-ylmethyl)pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCN(Cc2cnccn2)C1 |
| InChI | InChI=1S/C9H14N4.ClH/c10-8-1-4-13(6-8)7-9-5-11-2-3-12-9;/h2-3,5,8H,1,4,6-7,10H2;1H |
| InChIKey | KHBCPOUPVJXCCB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |