C11H16N2OS — CID 71644965
N-(pyrrolidin-3-ylmethyl)-2-thiophen-3-ylacetamide (PubChem CID 71644965) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is N-(pyrrolidin-3-ylmethyl)-2-thiophen-3-ylacetamide.
| Compound Name | N-(pyrrolidin-3-ylmethyl)-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 71644965 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-(pyrrolidin-3-ylmethyl)-2-thiophen-3-ylacetamide |
| SMILES | O=C(Cc1ccsc1)NCC1CCNC1 |
| InChI | InChI=1S/C11H16N2OS/c14-11(5-9-2-4-15-8-9)13-7-10-1-3-12-6-10/h2,4,8,10,12H,1,3,5-7H2,(H,13,14) |
| InChIKey | BSAPSXXHPWDFRW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |