About 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride
2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride (PubChem CID 71645049) has the molecular formula C9H14ClN3OS
and a molecular weight of 247.75 g/mol. Its IUPAC name is 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride.
Molecular Properties
| Compound Name | 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride |
| PubChem CID | 71645049 |
| Molecular Formula | C9H14ClN3OS |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride |
| SMILES | Cl.O=C(CNC1CCNC1)c1nccs1 |
| InChI | InChI=1S/C9H13N3OS.ClH/c13-8(9-11-3-4-14-9)6-12-7-1-2-10-5-7;/h3-4,7,10,12H,1-2,5-6H2;1H |
| InChIKey | DULLIDJRXKCANB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride?
The IUPAC name of 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride (CID 71645049) is 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride.
What is the SMILES notation for 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride?
The canonical SMILES for 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride is Cl.O=C(CNC1CCNC1)c1nccs1.
What is the InChIKey of 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride?
The InChIKey is DULLIDJRXKCANB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3OS.ClH/c13-8(9-11-3-4-14-9)6-12-7-1-2-10-5-7;/h3-4,7,10,12H,1-2,5-6H2;1H.
What are the key properties of 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride?
2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride has a molecular weight of 247.75 g/mol, XLogP of 0.70, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(pyrrolidin-3-ylamino)-1-(1,3-thiazol-2-yl)ethanone;hydrochloride is sourced from PubChem (CID 71645049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).