C9H14ClN3OS — CID 71646173
2-(pyrrolidin-3-ylmethylsulfinyl)pyrazine;hydrochloride (PubChem CID 71646173) has the molecular formula C9H14ClN3OS and a molecular weight of 247.75 g/mol. Its IUPAC name is 2-(pyrrolidin-3-ylmethylsulfinyl)pyrazine;hydrochloride.
| Compound Name | 2-(pyrrolidin-3-ylmethylsulfinyl)pyrazine;hydrochloride |
|---|---|
| PubChem CID | 71646173 |
| Molecular Formula | C9H14ClN3OS |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-(pyrrolidin-3-ylmethylsulfinyl)pyrazine;hydrochloride |
| SMILES | Cl.O=S(CC1CCNC1)c1cnccn1 |
| InChI | InChI=1S/C9H13N3OS.ClH/c13-14(7-8-1-2-10-5-8)9-6-11-3-4-12-9;/h3-4,6,8,10H,1-2,5,7H2;1H |
| InChIKey | WZKNRTCWWDJIGI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |