About N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine
N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine (PubChem CID 716462) has the molecular formula C21H17N3S
and a molecular weight of 343.46 g/mol. Its IUPAC name is N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine |
| PubChem CID | 716462 |
| Molecular Formula | C21H17N3S |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine |
| SMILES | c1ccc(/N=c2\scc(-c3ccccc3)n2Cc2cccnc2)cc1 |
| InChI | InChI=1S/C21H17N3S/c1-3-9-18(10-4-1)20-16-25-21(23-19-11-5-2-6-12-19)24(20)15-17-8-7-13-22-14-17/h1-14,16H,15H2/b23-21- |
| InChIKey | SPGWDSRXEQHWPK-LNVKXUELSA-N |
| XLogP | 4.89 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine?
The IUPAC name of N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine (CID 716462) is N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine.
What is the SMILES notation for N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine?
The canonical SMILES for N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine is c1ccc(/N=c2\scc(-c3ccccc3)n2Cc2cccnc2)cc1.
What is the InChIKey of N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine?
The InChIKey is SPGWDSRXEQHWPK-LNVKXUELSA-N. The full InChI is InChI=1S/C21H17N3S/c1-3-9-18(10-4-1)20-16-25-21(23-19-11-5-2-6-12-19)24(20)15-17-8-7-13-22-14-17/h1-14,16H,15H2/b23-21-.
What are the key properties of N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine?
N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine has a molecular weight of 343.46 g/mol, XLogP of 4.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-diphenyl-3-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine is sourced from PubChem (CID 716462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).