About 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid
4-methylfuro[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 7164641) has the molecular formula C8H7NO3
and a molecular weight of 165.15 g/mol. Its IUPAC name is 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid |
| PubChem CID | 7164641 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | Cn1c(C(=O)O)cc2occc21 |
| InChI | InChI=1S/C8H7NO3/c1-9-5-2-3-12-7(5)4-6(9)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | ITEWRYWRNQCNHT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid (CID 7164641) is 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid is Cn1c(C(=O)O)cc2occc21.
What is the InChIKey of 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is ITEWRYWRNQCNHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3/c1-9-5-2-3-12-7(5)4-6(9)8(10)11/h2-4H,1H3,(H,10,11).
What are the key properties of 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid?
4-methylfuro[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 165.15 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylfuro[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 7164641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).