C8H12N2O2S — CID 71646856
N,N,5-trimethylpyridine-2-sulfonamide (PubChem CID 71646856) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is N,N,5-trimethylpyridine-2-sulfonamide.
| Compound Name | N,N,5-trimethylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 71646856 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N,N,5-trimethylpyridine-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)nc1 |
| InChI | InChI=1S/C8H12N2O2S/c1-7-4-5-8(9-6-7)13(11,12)10(2)3/h4-6H,1-3H3 |
| InChIKey | TXYNXLQOQQDTFL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |