C17H26N4O3 — CID 71647139
tert-butyl N-methyl-N-[1-(2-oxo-2-pyrazin-2-ylethyl)piperidin-4-yl]carbamate (PubChem CID 71647139) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-(2-oxo-2-pyrazin-2-ylethyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-(2-oxo-2-pyrazin-2-ylethyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 71647139 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | tert-butyl N-methyl-N-[1-(2-oxo-2-pyrazin-2-ylethyl)piperidin-4-yl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCN(CC(=O)c2cnccn2)CC1 |
| InChI | InChI=1S/C17H26N4O3/c1-17(2,3)24-16(23)20(4)13-5-9-21(10-6-13)12-15(22)14-11-18-7-8-19-14/h7-8,11,13H,5-6,9-10,12H2,1-4H3 |
| InChIKey | MIQQXBVHRULCJO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |