About 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone
1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone (PubChem CID 716472) has the molecular formula C10H8ClN3O
and a molecular weight of 221.65 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| PubChem CID | 716472 |
| Molecular Formula | C10H8ClN3O |
| Molecular Weight | 221.65 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| SMILES | O=C(Cn1cncn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H8ClN3O/c11-9-3-1-8(2-4-9)10(15)5-14-7-12-6-13-14/h1-4,6-7H,5H2 |
| InChIKey | ZDGXDQYBMSMZLC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.65 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone?
The IUPAC name of 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone (CID 716472) is 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone.
What is the SMILES notation for 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone?
The canonical SMILES for 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone is O=C(Cn1cncn1)c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone?
The InChIKey is ZDGXDQYBMSMZLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClN3O/c11-9-3-1-8(2-4-9)10(15)5-14-7-12-6-13-14/h1-4,6-7H,5H2.
What are the key properties of 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone?
1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone has a molecular weight of 221.65 g/mol, XLogP of 1.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone is sourced from PubChem (CID 716472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).