C16H25N3O2 — CID 71647440
tert-butyl (3S)-3-[methyl(pyridin-4-ylmethyl)amino]pyrrolidine-1-carboxylate (PubChem CID 71647440) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is tert-butyl (3S)-3-[methyl(pyridin-4-ylmethyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[methyl(pyridin-4-ylmethyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71647440 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | tert-butyl (3S)-3-[methyl(pyridin-4-ylmethyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CN(Cc1ccncc1)[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H25N3O2/c1-16(2,3)21-15(20)19-10-7-14(12-19)18(4)11-13-5-8-17-9-6-13/h5-6,8-9,14H,7,10-12H2,1-4H3/t14-/m0/s1 |
| InChIKey | DVPFHLXWSKHUJV-AWEZNQCLSA-N |
| XLogP | 2.52 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |