C16H24BrN3O2 — CID 71647751
tert-butyl 3-[[(6-bromo-2-pyridinyl)-methylamino]methyl]pyrrolidine-1-carboxylate (PubChem CID 71647751) has the molecular formula C16H24BrN3O2 and a molecular weight of 370.29 g/mol. Its IUPAC name is tert-butyl 3-[[(6-bromo-2-pyridinyl)-methylamino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(6-bromo-2-pyridinyl)-methylamino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71647751 |
| Molecular Formula | C16H24BrN3O2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | tert-butyl 3-[[(6-bromo-2-pyridinyl)-methylamino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CN(CC1CCN(C(=O)OC(C)(C)C)C1)c1cccc(Br)n1 |
| InChI | InChI=1S/C16H24BrN3O2/c1-16(2,3)22-15(21)20-9-8-12(11-20)10-19(4)14-7-5-6-13(17)18-14/h5-7,12H,8-11H2,1-4H3 |
| InChIKey | LUTJZSWXJUUFRQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|