C15H20FNO3S — CID 71648912
N-cyclopropyl-3-[(3-fluorophenyl)methyl]oxane-4-sulfonamide (PubChem CID 71648912) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is N-cyclopropyl-3-[(3-fluorophenyl)methyl]oxane-4-sulfonamide.
| Compound Name | N-cyclopropyl-3-[(3-fluorophenyl)methyl]oxane-4-sulfonamide |
|---|---|
| PubChem CID | 71648912 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-cyclopropyl-3-[(3-fluorophenyl)methyl]oxane-4-sulfonamide |
| SMILES | O=S(=O)(NC1CC1)C1CCOCC1Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H20FNO3S/c16-13-3-1-2-11(9-13)8-12-10-20-7-6-15(12)21(18,19)17-14-4-5-14/h1-3,9,12,14-15,17H,4-8,10H2 |
| InChIKey | FGXDGQOQHAKKIB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |