C11H14N2O2 — CID 71649464
2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-pyridin-2-ylethanone (PubChem CID 71649464) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-pyridin-2-ylethanone.
| Compound Name | 2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 71649464 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-pyridin-2-ylethanone |
| SMILES | O=C(CN1CC[C@H](O)C1)c1ccccn1 |
| InChI | InChI=1S/C11H14N2O2/c14-9-4-6-13(7-9)8-11(15)10-3-1-2-5-12-10/h1-3,5,9,14H,4,6-8H2/t9-/m0/s1 |
| InChIKey | CUXGYSYKOFEOFW-VIFPVBQESA-N |
| XLogP | 0.33 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |