About 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one
7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one (PubChem CID 71649500) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one.
Molecular Properties
| Compound Name | 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one |
| PubChem CID | 71649500 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one |
| SMILES | O=C1CC2(CCN(C3CC3)CC2)N1 |
| InChI | InChI=1S/C10H16N2O/c13-9-7-10(11-9)3-5-12(6-4-10)8-1-2-8/h8H,1-7H2,(H,11,13) |
| InChIKey | WFFJQULYWLCDIK-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one?
The IUPAC name of 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one (CID 71649500) is 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one.
What is the SMILES notation for 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one?
The canonical SMILES for 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one is O=C1CC2(CCN(C3CC3)CC2)N1.
What is the InChIKey of 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one?
The InChIKey is WFFJQULYWLCDIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c13-9-7-10(11-9)3-5-12(6-4-10)8-1-2-8/h8H,1-7H2,(H,11,13).
What are the key properties of 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one?
7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one has a molecular weight of 180.25 g/mol, XLogP of 0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclopropyl-1,7-diazaspiro[3.5]nonan-2-one is sourced from PubChem (CID 71649500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).