C18H17Cl2N3O — CID 71649801
1-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]pyrrolidin-3-ol (PubChem CID 71649801) has the molecular formula C18H17Cl2N3O and a molecular weight of 362.26 g/mol. Its IUPAC name is 1-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]pyrrolidin-3-ol.
| Compound Name | 1-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 71649801 |
| Molecular Formula | C18H17Cl2N3O |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 1-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]pyrrolidin-3-ol |
| SMILES | OC1CCN(c2nc3ccccc3n2Cc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C18H17Cl2N3O/c19-14-4-3-5-15(20)13(14)11-23-17-7-2-1-6-16(17)21-18(23)22-9-8-12(24)10-22/h1-7,12,24H,8-11H2 |
| InChIKey | SNJHQUZCLXJBKR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |