C10H6BrF2NO — CID 71650394
4-(bromomethyl)-7,8-difluoro-8H-quinolin-2-one (PubChem CID 71650394) has the molecular formula C10H6BrF2NO and a molecular weight of 274.06 g/mol. Its IUPAC name is 4-(bromomethyl)-7,8-difluoro-8H-quinolin-2-one.
| Compound Name | 4-(bromomethyl)-7,8-difluoro-8H-quinolin-2-one |
|---|---|
| PubChem CID | 71650394 |
| Molecular Formula | C10H6BrF2NO |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | 4-(bromomethyl)-7,8-difluoro-8H-quinolin-2-one |
| SMILES | O=C1C=C(CBr)C2=CC=C(F)C(F)C2=N1 |
| InChI | InChI=1S/C10H6BrF2NO/c11-4-5-3-8(15)14-10-6(5)1-2-7(12)9(10)13/h1-3,9H,4H2 |
| InChIKey | IIHCRDSBDDZHQW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|