About Pentafluoropropanoic acid sodium
Pentafluoropropanoic acid sodium (PubChem CID 71650614) has the molecular formula C3HF5NaO2
and a molecular weight of 187.02 g/mol.
Molecular Properties
| Compound Name | Pentafluoropropanoic acid sodium |
| PubChem CID | 71650614 |
| Molecular Formula | C3HF5NaO2 |
| Molecular Weight | 187.02 g/mol |
| Exact Mass | 186.98 |
| IUPAC Name | — |
| SMILES | O=C(O)C(F)(F)C(F)(F)F.[Na] |
| InChI | InChI=1S/C3HF5O2.Na/c4-2(5,1(9)10)3(6,7)8;/h(H,9,10); |
| InChIKey | JEBRSEGXGIEJTP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.02 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|
Analyze Pentafluoropropanoic acid sodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Pentafluoropropanoic acid sodium?
The IUPAC name of Pentafluoropropanoic acid sodium (CID 71650614) is not available.
What is the SMILES notation for Pentafluoropropanoic acid sodium?
The canonical SMILES for Pentafluoropropanoic acid sodium is O=C(O)C(F)(F)C(F)(F)F.[Na].
What is the InChIKey of Pentafluoropropanoic acid sodium?
The InChIKey is JEBRSEGXGIEJTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HF5O2.Na/c4-2(5,1(9)10)3(6,7)8;/h(H,9,10);.
What are the key properties of Pentafluoropropanoic acid sodium?
Pentafluoropropanoic acid sodium has a molecular weight of 187.02 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Pentafluoropropanoic acid sodium is sourced from PubChem (CID 71650614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).