C10H9ClN2O2 — CID 71650918
3-(2-chloroethyl)-4aH-quinazoline-2,4-dione (PubChem CID 71650918) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is 3-(2-chloroethyl)-4aH-quinazoline-2,4-dione.
| Compound Name | 3-(2-chloroethyl)-4aH-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 71650918 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 3-(2-chloroethyl)-4aH-quinazoline-2,4-dione |
| SMILES | O=C1N=C2C=CC=CC2C(=O)N1CCCl |
| InChI | InChI=1S/C10H9ClN2O2/c11-5-6-13-9(14)7-3-1-2-4-8(7)12-10(13)15/h1-4,7H,5-6H2 |
| InChIKey | AVTGEWUBMHDDJM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|