About 5-(chloromethyl)-1,2,4-triazolidin-3-one
5-(chloromethyl)-1,2,4-triazolidin-3-one (PubChem CID 71650994) has the molecular formula C3H6ClN3O
and a molecular weight of 135.55 g/mol. Its IUPAC name is 5-(chloromethyl)-1,2,4-triazolidin-3-one.
Molecular Properties
| Compound Name | 5-(chloromethyl)-1,2,4-triazolidin-3-one |
| PubChem CID | 71650994 |
| Molecular Formula | C3H6ClN3O |
| Molecular Weight | 135.55 g/mol |
| Exact Mass | 135.02 |
| IUPAC Name | 5-(chloromethyl)-1,2,4-triazolidin-3-one |
| SMILES | O=C1NNC(CCl)N1 |
| InChI | InChI=1S/C3H6ClN3O/c4-1-2-5-3(8)7-6-2/h2,6H,1H2,(H2,5,7,8) |
| InChIKey | NUTGSJMIXFRLCD-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.55 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-1,2,4-triazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-1,2,4-triazolidin-3-one?
The IUPAC name of 5-(chloromethyl)-1,2,4-triazolidin-3-one (CID 71650994) is 5-(chloromethyl)-1,2,4-triazolidin-3-one.
What is the SMILES notation for 5-(chloromethyl)-1,2,4-triazolidin-3-one?
The canonical SMILES for 5-(chloromethyl)-1,2,4-triazolidin-3-one is O=C1NNC(CCl)N1.
What is the InChIKey of 5-(chloromethyl)-1,2,4-triazolidin-3-one?
The InChIKey is NUTGSJMIXFRLCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6ClN3O/c4-1-2-5-3(8)7-6-2/h2,6H,1H2,(H2,5,7,8).
What are the key properties of 5-(chloromethyl)-1,2,4-triazolidin-3-one?
5-(chloromethyl)-1,2,4-triazolidin-3-one has a molecular weight of 135.55 g/mol, XLogP of -0.63, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-1,2,4-triazolidin-3-one is sourced from PubChem (CID 71650994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).