About 5-methoxy-1,3-diazinane-2,4-dione
5-methoxy-1,3-diazinane-2,4-dione (PubChem CID 71650995) has the molecular formula C5H8N2O3
and a molecular weight of 144.13 g/mol. Its IUPAC name is 5-methoxy-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 5-methoxy-1,3-diazinane-2,4-dione |
| PubChem CID | 71650995 |
| Molecular Formula | C5H8N2O3 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 5-methoxy-1,3-diazinane-2,4-dione |
| SMILES | COC1CNC(=O)NC1=O |
| InChI | InChI=1S/C5H8N2O3/c1-10-3-2-6-5(9)7-4(3)8/h3H,2H2,1H3,(H2,6,7,8,9) |
| InChIKey | LIHLEUSPWFXEDO-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,3-diazinane-2,4-dione?
The IUPAC name of 5-methoxy-1,3-diazinane-2,4-dione (CID 71650995) is 5-methoxy-1,3-diazinane-2,4-dione.
What is the SMILES notation for 5-methoxy-1,3-diazinane-2,4-dione?
The canonical SMILES for 5-methoxy-1,3-diazinane-2,4-dione is COC1CNC(=O)NC1=O.
What is the InChIKey of 5-methoxy-1,3-diazinane-2,4-dione?
The InChIKey is LIHLEUSPWFXEDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O3/c1-10-3-2-6-5(9)7-4(3)8/h3H,2H2,1H3,(H2,6,7,8,9).
What are the key properties of 5-methoxy-1,3-diazinane-2,4-dione?
5-methoxy-1,3-diazinane-2,4-dione has a molecular weight of 144.13 g/mol, XLogP of -1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,3-diazinane-2,4-dione is sourced from PubChem (CID 71650995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).