C9H12ClN4O2+ — CID 71651024
7-(2-chloroethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 71651024) has the molecular formula C9H12ClN4O2+ and a molecular weight of 243.67 g/mol. Its IUPAC name is 7-(2-chloroethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2-chloroethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 71651024 |
| Molecular Formula | C9H12ClN4O2+ |
| Molecular Weight | 243.67 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 7-(2-chloroethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CCCl)N(C)C1=O |
| InChI | InChI=1S/C9H12ClN4O2/c1-12-7-6(8(15)13(2)9(12)16)14(4-3-10)5-11-7/h5-6H,3-4H2,1-2H3/q+1 |
| InChIKey | TUSTWRHLVNVSTE-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.67 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|