C14H12Cl2O — CID 71651492
1,4-dichloro-2-[(4-methylphenyl)methoxy]benzene (PubChem CID 71651492) has the molecular formula C14H12Cl2O and a molecular weight of 267.16 g/mol. Its IUPAC name is 1,4-dichloro-2-[(4-methylphenyl)methoxy]benzene.
| Compound Name | 1,4-dichloro-2-[(4-methylphenyl)methoxy]benzene |
|---|---|
| PubChem CID | 71651492 |
| Molecular Formula | C14H12Cl2O |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 1,4-dichloro-2-[(4-methylphenyl)methoxy]benzene |
| SMILES | Cc1ccc(COc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C14H12Cl2O/c1-10-2-4-11(5-3-10)9-17-14-8-12(15)6-7-13(14)16/h2-8H,9H2,1H3 |
| InChIKey | ITSHAYFUMNXPEU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |