About diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane
diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane (PubChem CID 71651620) has the molecular formula C33H37P
and a molecular weight of 464.63 g/mol. Its IUPAC name is diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane.
Molecular Properties
| Compound Name | diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| PubChem CID | 71651620 |
| Molecular Formula | C33H37P |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| SMILES | CC(C)c1cc(C(C)C)c(-c2ccccc2P(c2ccccc2)c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C33H37P/c1-23(2)26-21-30(24(3)4)33(31(22-26)25(5)6)29-19-13-14-20-32(29)34(27-15-9-7-10-16-27)28-17-11-8-12-18-28/h7-25H,1-6H3 |
| InChIKey | HCULUUWFPUUYEE-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane?
The IUPAC name of diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane (CID 71651620) is diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane.
What is the SMILES notation for diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane?
The canonical SMILES for diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane is CC(C)c1cc(C(C)C)c(-c2ccccc2P(c2ccccc2)c2ccccc2)c(C(C)C)c1.
What is the InChIKey of diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane?
The InChIKey is HCULUUWFPUUYEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H37P/c1-23(2)26-21-30(24(3)4)33(31(22-26)25(5)6)29-19-13-14-20-32(29)34(27-15-9-7-10-16-27)28-17-11-8-12-18-28/h7-25H,1-6H3.
What are the key properties of diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane?
diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane has a molecular weight of 464.63 g/mol, XLogP of 8.48, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane is sourced from PubChem (CID 71651620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).