C22H20O4 — CID 71652397
1,2,3-trimethoxy-5-[(Z)-6-(2-methoxyphenyl)hex-3-en-1,5-diynyl]benzene (PubChem CID 71652397) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(Z)-6-(2-methoxyphenyl)hex-3-en-1,5-diynyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(Z)-6-(2-methoxyphenyl)hex-3-en-1,5-diynyl]benzene |
|---|---|
| PubChem CID | 71652397 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(Z)-6-(2-methoxyphenyl)hex-3-en-1,5-diynyl]benzene |
| SMILES | COc1ccccc1C#C/C=C\C#Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H20O4/c1-23-19-14-10-9-13-18(19)12-8-6-5-7-11-17-15-20(24-2)22(26-4)21(16-17)25-3/h5-6,9-10,13-16H,1-4H3/b6-5- |
| InChIKey | CPKVOOHRBGTQFH-WAYWQWQTSA-N |
| XLogP | 3.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|